9,10-dimethoxy-2,9,10-trimethyl-anthracene structure
|
Common Name | 9,10-dimethoxy-2,9,10-trimethyl-anthracene | ||
|---|---|---|---|---|
| CAS Number | 6321-69-3 | Molecular Weight | 282.37700 | |
| Density | 1.09g/cm3 | Boiling Point | 369ºC at 760 mmHg | |
| Molecular Formula | C19H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 131.9ºC | |
| Name | 9,10-dimethoxy-2,9,10-trimethylanthracene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 369ºC at 760 mmHg |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.37700 |
| Flash Point | 131.9ºC |
| Exact Mass | 282.16200 |
| PSA | 18.46000 |
| LogP | 4.12820 |
| Index of Refraction | 1.575 |
| InChIKey | VBECEVIVQHDFRJ-UHFFFAOYSA-N |
| SMILES | COC1(C)c2ccccc2C(C)(OC)c2cc(C)ccc21 |
|
~%
9,10-dimethoxy-... CAS#:6321-69-3 |
| Literature: Bachmann, Chemerda Journal of Organic Chemistry, 1939 , vol. 4, p. 583,586 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 9,10-dimethoxy-2,9,10-trimethyl-9,10-dihydro-anthracene |