9 10-dimethoxy-2-anthracenesulfonic aci& structure
|
Common Name | 9 10-dimethoxy-2-anthracenesulfonic aci& | ||
|---|---|---|---|---|
| CAS Number | 207233-92-9 | Molecular Weight | 358.34100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15NaO6S | Melting Point | >300ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | sodium,9,10-dimethoxyanthracene-2-sulfonate,hydrate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | >300ºC(lit.) |
|---|---|
| Molecular Formula | C16H15NaO6S |
| Molecular Weight | 358.34100 |
| Exact Mass | 358.04900 |
| PSA | 93.27000 |
| LogP | 3.93080 |
| InChIKey | NGXAGKVEVBJNRP-UHFFFAOYSA-M |
| SMILES | COc1c2ccccc2c(OC)c2cc(S(=O)(=O)[O-])ccc12.O.[Na+] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
Aqueous soft matter based photovoltaic devices. Koo H-J, et al.
J. Mater. Chem. 21(1) , 72-79, (2011)
|
|
|
A new sensitive fluorimetric method for the determination of heptaminol and mexiletine in pharmaceuticals. EL-ADL SM.
Sci. Pharm. 70(1) , 57-65, (2002)
|
| MFCD00150645 |
| 9,10-Dimethoxy-2-anthracenesulfonic acid sodium salt monohydrate |