4-hydroxy-3,4-diphenyl-2,5-dipropyl-cyclopent-2-en-1-one structure
|
Common Name | 4-hydroxy-3,4-diphenyl-2,5-dipropyl-cyclopent-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 6322-24-3 | Molecular Weight | 334.45100 | |
| Density | 1.091g/cm3 | Boiling Point | 436.6ºC at 760 mmHg | |
| Molecular Formula | C23H26O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 186.2ºC | |
| Name | 4-hydroxy-3,4-diphenyl-2,5-dipropylcyclopent-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.091g/cm3 |
|---|---|
| Boiling Point | 436.6ºC at 760 mmHg |
| Molecular Formula | C23H26O2 |
| Molecular Weight | 334.45100 |
| Flash Point | 186.2ºC |
| Exact Mass | 334.19300 |
| PSA | 37.30000 |
| LogP | 5.12710 |
| Index of Refraction | 1.573 |
| InChIKey | XAYKGPNIVWPWTC-UHFFFAOYSA-N |
| SMILES | CCCC1=C(c2ccccc2)C(O)(c2ccccc2)C(CCC)C1=O |
|
~%
4-hydroxy-3,4-d... CAS#:6322-24-3 |
| Literature: Allen; VanAllan Journal of the American Chemical Society, 1950 , vol. 72, p. 5165 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 4-hydroxy-3,4-diphenyl-2,5-dipropyl-cyclopent-2-enone |