4-[3-(4-phenylpiperazin-1-yl)propyl]morpholine structure
|
Common Name | 4-[3-(4-phenylpiperazin-1-yl)propyl]morpholine | ||
|---|---|---|---|---|
| CAS Number | 6323-08-6 | Molecular Weight | 289.41600 | |
| Density | 1.066g/cm3 | Boiling Point | 432.8ºC at 760 mmHg | |
| Molecular Formula | C17H27N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 126.2ºC | |
| Name | 4-[3-(4-phenylpiperazin-1-yl)propyl]morpholine |
|---|
| Density | 1.066g/cm3 |
|---|---|
| Boiling Point | 432.8ºC at 760 mmHg |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.41600 |
| Flash Point | 126.2ºC |
| Exact Mass | 289.21500 |
| PSA | 18.95000 |
| LogP | 1.47170 |
| Index of Refraction | 1.543 |
| InChIKey | ZIQIWAMHRLKSBL-UHFFFAOYSA-N |
| SMILES | c1ccc(N2CCN(CCCN3CCOCC3)CC2)cc1 |
|
~%
4-[3-(4-phenylp... CAS#:6323-08-6 |
| Literature: Pollard et al. Journal of Organic Chemistry, 1959 , vol. 24, p. 764 |
|
~%
4-[3-(4-phenylp... CAS#:6323-08-6 |
| Literature: Pollard et al. Journal of Organic Chemistry, 1959 , vol. 24, p. 764 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |