Furan, 2-[2- (2-chlorophenyl)-2-nitroethenyl]- structure
|
Common Name | Furan, 2-[2- (2-chlorophenyl)-2-nitroethenyl]- | ||
|---|---|---|---|---|
| CAS Number | 6323-80-4 | Molecular Weight | 249.65000 | |
| Density | 1.36g/cm3 | Boiling Point | 344ºC at 760 mmHg | |
| Molecular Formula | C12H8ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.9ºC | |
| Name | 2-[(Z)-2-(2-chlorophenyl)-2-nitroethenyl]furan |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 344ºC at 760 mmHg |
| Molecular Formula | C12H8ClNO3 |
| Molecular Weight | 249.65000 |
| Flash Point | 161.9ºC |
| Exact Mass | 249.01900 |
| PSA | 58.96000 |
| LogP | 4.23100 |
| Index of Refraction | 1.632 |
| InChIKey | XQZZLJFMWIPDNG-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])C(=Cc1ccco1)c1ccccc1Cl |
|
~%
Furan, 2-[2- (2... CAS#:6323-80-4 |
| Literature: Bahner; Dickson; Moore Journal of the American Chemical Society, 1948 , vol. 70, p. 1982 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-(2-Chlor-propionyloxy)-propionsaeure |
| 2-(2-chloro-propionyloxy)-propionic acid |