1-bromo-4-(4-methylphenyl)sulfonyloxy-benzene structure
|
Common Name | 1-bromo-4-(4-methylphenyl)sulfonyloxy-benzene | ||
|---|---|---|---|---|
| CAS Number | 6324-15-8 | Molecular Weight | 327.19400 | |
| Density | 1.517g/cm3 | Boiling Point | 430.6ºC at 760 mmHg | |
| Molecular Formula | C13H11BrO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.2ºC | |
| Name | (4-bromophenyl) 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.517g/cm3 |
|---|---|
| Boiling Point | 430.6ºC at 760 mmHg |
| Molecular Formula | C13H11BrO3S |
| Molecular Weight | 327.19400 |
| Flash Point | 214.2ºC |
| Exact Mass | 325.96100 |
| PSA | 51.75000 |
| LogP | 4.60600 |
| Index of Refraction | 1.606 |
| InChIKey | XXDAIEWTMDQCEL-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(Br)cc2)cc1 |
|
~89%
1-bromo-4-(4-me... CAS#:6324-15-8 |
| Literature: Reddy, M. B. Madhusudana; Pasha Phosphorus, Sulfur and Silicon and the Related Elements, 2011 , vol. 186, # 9 p. 1867 - 1875 |
|
~%
1-bromo-4-(4-me... CAS#:6324-15-8 |
| Literature: Piller, Fabian M.; Metzger, Albrecht; Schade, Matthias A.; Haag, Benjamin A.; Gavryushin, Andrei; Knochel, Paul Chemistry - A European Journal, 2009 , vol. 15, # 29 p. 7192 - 7202 |
| toluene-4-sulfonic acid 4-bromo-phenyl ester |
| 4-bromophenyl 4-toluenesulfonate |
| 4-bromophenyl 4-methylbenzenesulfonate |
| 4-bromophenyl tosylate |
| Toluol-4-sulfonsaeure-(4-brom-phenylester) |
| Phenol,p-bromo-,p-toluene-sulfonate |