4-Nitrobenzenesulfonamide structure
|
Common Name | 4-Nitrobenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 6325-93-5 | Molecular Weight | 202.18800 | |
| Density | 1.552 g/cm3 | Boiling Point | 417.8ºC at 760 mmHg | |
| Molecular Formula | C6H6N2O4S | Melting Point | 178-180 °C(lit.) | |
| MSDS | USA | Flash Point | 206.5ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-Nitrobenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.552 g/cm3 |
|---|---|
| Boiling Point | 417.8ºC at 760 mmHg |
| Melting Point | 178-180 °C(lit.) |
| Molecular Formula | C6H6N2O4S |
| Molecular Weight | 202.18800 |
| Flash Point | 206.5ºC |
| Exact Mass | 202.00500 |
| PSA | 114.36000 |
| LogP | 2.54650 |
| Index of Refraction | 1.611 |
| InChIKey | QWKKYJLAUWFPDB-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R20/21/22;R36/37/38 |
| Safety Phrases | S26-S37/39-S36/37/39-S22 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | DB2975000 |
| HS Code | 2935009090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|
Engineering towards nitroreductase functionality in ene-reductase scaffolds.
ChemBioChem. 16(5) , 811-8, (2015) Nitroreductases (NRs) and ene-reductases (ERs) both utilize flavin mononucleotide cofactors but catalyze distinct reactions. NRs reduce nitroaromatics, whereas ERs reduce unsaturated C=C double bonds,... |
|
|
Copper (I)-catalyzed asymmetric alkene aziridination mediated by PhI (OAc)< sub> 2</sub>: a facile one-pot procedure. Kwong HL, et al.
Tetrahedron Lett. 45(20) , 3965-3968, (2004)
|
|
|
The 1: 2 and 1: 1 molecular complexes of N,N'-dibenzyl-4, 13-diaza-18-crown-6 with 4-nitrobenzenesulfonamide and dithiooxamide. Fonari MS, et al.
J. Mol. Struct. 794(1) , 110-114, (2006)
|
|
Name: Substrate activity at recombinant Haemophilus influenzae Chloramphenicol nitroreducta...
Source: ChEMBL
Target: N/A
External Id: CHEMBL4320927
|
|
Name: Experimentally measured binding affinity data (Ki) for protein-ligand complexes deriv...
Source: Shanghai Institute of Organic Chemistry
Target: N/A
External Id: PDBbind-Ki for protein-ligand complexes
|
|
Name: Stimulation of Amyloid beta (1 to 40) (unknown origin) fibril formation at Abeta:comp...
Source: ChEMBL
Target: Amyloid-beta precursor protein
External Id: CHEMBL3380194
|
|
Name: Inhibitory concentration against human cystolic isozyme II of Carbonic anhydrase
Source: ChEMBL
Target: Carbonic anhydrase 2
External Id: CHEMBL828069
|
|
Name: Binding affinity to bovine carbonic anhydrase 2
Source: ChEMBL
Target: Carbonic anhydrase 2
External Id: CHEMBL1647881
|
|
Name: Small-molecule inhibitors of ST2 (IL1RL1)
Source: 20881
Target: interleukin-1 receptor-like 1 isoform [homo sapiens]
External Id: ST2_IL33_Inhibitors_Primary_Screening_77700
|
|
Name: Inhibition of Amyloid beta (1 to 42) (unknown origin) oligomer assembly at Abeta:comp...
Source: ChEMBL
Target: Amyloid-beta precursor protein
External Id: CHEMBL3380198
|
|
Name: CHCl3-water partition coefficient, log P of the compound
Source: ChEMBL
Target: N/A
External Id: CHEMBL3256049
|
| 4-Nitrobenzolesulfamide |
| 4-Nitrobenzenesulphonamide |
| Benzenesulfonamide,p-nitro |
| EINECS 228-691-6 |
| Benzenesulfonamide,4-nitro |
| p-Nitrophenylsulfonamide |
| 4-Nitro-benzenesulfonamide |
| MFCD00007937 |
| p-Nitrobenzene sulphonamide |
| 4-nitrophenylsulfonamide |
| p-Nitrobenzenesulfonamide |
| p-nosyl-NH2 |