1-phenyl-N-(9H-xanthen-9-yl)methanesulfonamide structure
|
Common Name | 1-phenyl-N-(9H-xanthen-9-yl)methanesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 6326-05-2 | Molecular Weight | 351.41900 | |
| Density | 1.36g/cm3 | Boiling Point | 519.2ºC at 760 mmHg | |
| Molecular Formula | C20H17NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 267.8ºC | |
| Name | 1-phenyl-N-(9H-xanthen-9-yl)methanesulfonamide |
|---|
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 519.2ºC at 760 mmHg |
| Molecular Formula | C20H17NO3S |
| Molecular Weight | 351.41900 |
| Flash Point | 267.8ºC |
| Exact Mass | 351.09300 |
| PSA | 63.78000 |
| LogP | 5.47300 |
| Index of Refraction | 1.684 |
| InChIKey | BBSYUJFFVGJEQN-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cc1ccccc1)NC1c2ccccc2Oc2ccccc21 |
|
~%
1-phenyl-N-(9H-... CAS#:6326-05-2 |
| Literature: Bond; Luttermoser Journal of the American Pharmaceutical Association (1912-1977), 1954 , vol. 43, p. 32,33 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |