4-nitro-N-(9H-xanthen-9-yl)benzenesulfonamide structure
|
Common Name | 4-nitro-N-(9H-xanthen-9-yl)benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 6319-57-9 | Molecular Weight | 382.39000 | |
| Density | 1.51g/cm3 | Boiling Point | 564.6ºC at 760 mmHg | |
| Molecular Formula | C19H14N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 295.2ºC | |
| Name | 4-nitro-benzenesulfonic acid trans-cinnamylidenehydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.51g/cm3 |
|---|---|
| Boiling Point | 564.6ºC at 760 mmHg |
| Molecular Formula | C19H14N2O5S |
| Molecular Weight | 382.39000 |
| Flash Point | 295.2ºC |
| Exact Mass | 382.06200 |
| PSA | 109.60000 |
| LogP | 5.76330 |
| Index of Refraction | 1.715 |
| InChIKey | ANDNJENYPXSPNU-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)NC2c3ccccc3Oc3ccccc32)cc1 |
|
~79%
4-nitro-N-(9H-x... CAS#:6319-57-9 |
| Literature: Liu, Yungen; Guan, Xiangguo; Wong, Ella Lai-Ming; Liu, Peng; Huang, Jie-Sheng; Che, Chi-Ming Journal of the American Chemical Society, 2013 , vol. 135, # 19 p. 7194 - 7204 |
|
~%
4-nitro-N-(9H-x... CAS#:6319-57-9 |
| Literature: Bond; Luttermoser Journal of the American Pharmaceutical Association (1912-1977), 1954 , vol. 43, p. 32,33 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-Nitro-benzolsulfonsaeure-xanthen-9-ylamid |
| 4-nitro-benzenesulfonic acid xanthen-9-ylamide |
| 4-Nitro-benzolsulfonsaeure-trans-cinnamylidenhydrazid |
| 4-(Hydroxy(oxido)amino)-N'-(3-phenyl-2-propenylidene)benzenesulfonohydrazide |