Quinoxaline,2-(hexahydro-1H-azepin-1-yl)-3-(4-morpholinyl)- structure
|
Common Name | Quinoxaline,2-(hexahydro-1H-azepin-1-yl)-3-(4-morpholinyl)- | ||
|---|---|---|---|---|
| CAS Number | 6327-77-1 | Molecular Weight | 312.40900 | |
| Density | 1.186g/cm3 | Boiling Point | 505.9ºC at 760mmHg | |
| Molecular Formula | C18H24N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 259.7ºC | |
| Name | 4-[3-(azepan-1-yl)quinoxalin-2-yl]morpholine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.186g/cm3 |
|---|---|
| Boiling Point | 505.9ºC at 760mmHg |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.40900 |
| Flash Point | 259.7ºC |
| Exact Mass | 312.19500 |
| PSA | 41.49000 |
| LogP | 2.97680 |
| Index of Refraction | 1.611 |
| InChIKey | IVJSOQZQXBBFRO-UHFFFAOYSA-N |
| SMILES | c1ccc2nc(N3CCOCC3)c(N3CCCCCC3)nc2c1 |
|
~%
Quinoxaline,2-(... CAS#:6327-77-1 |
| Literature: Vaughan,W.R.; Habib,M.S. Journal of Organic Chemistry, 1962 , vol. 27, p. 324 - 327 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-azepan-1-yl-3-morpholin-4-yl-quinoxaline |
| 2-Morpholino-3-hexamethylenimino-chinoxalin |