N,N-bis(2-chloropropyl)-4-methoxy-aniline structure
|
Common Name | N,N-bis(2-chloropropyl)-4-methoxy-aniline | ||
|---|---|---|---|---|
| CAS Number | 6328-57-0 | Molecular Weight | 276.20200 | |
| Density | 1.146g/cm3 | Boiling Point | 375.7ºC at 760 mmHg | |
| Molecular Formula | C13H19Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181ºC | |
| Name | N,N-bis(2-chloropropyl)-4-methoxyaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.146g/cm3 |
|---|---|
| Boiling Point | 375.7ºC at 760 mmHg |
| Molecular Formula | C13H19Cl2NO |
| Molecular Weight | 276.20200 |
| Flash Point | 181ºC |
| Exact Mass | 275.08400 |
| PSA | 12.47000 |
| LogP | 3.75620 |
| Index of Refraction | 1.538 |
|
~%
N,N-bis(2-chlor... CAS#:6328-57-0 |
| Literature: Everett; Ross Journal of the Chemical Society, 1949 , p. 1972,1974 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N,N-Bis-(2-chlor-propyl)-p-anisidin |
| N,N-bis-(2-chloro-propyl)-p-anisidine |