(Z)-3-[[4-[[4-(3-carboxyprop-2-enoylamino)phenyl]methyl]phenyl]carbamoyl]prop-2-enoic acid structure
|
Common Name | (Z)-3-[[4-[[4-(3-carboxyprop-2-enoylamino)phenyl]methyl]phenyl]carbamoyl]prop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 6330-01-4 | Molecular Weight | 394.37700 | |
| Density | 1.421g/cm3 | Boiling Point | 754.4ºC at 760 mmHg | |
| Molecular Formula | C21H18N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 410.1ºC | |
| Name | (Z)-4-[4-[[4-[[(Z)-3-carboxyprop-2-enoyl]amino]phenyl]methyl]anilino]-4-oxobut-2-enoic acid |
|---|
| Density | 1.421g/cm3 |
|---|---|
| Boiling Point | 754.4ºC at 760 mmHg |
| Molecular Formula | C21H18N2O6 |
| Molecular Weight | 394.37700 |
| Flash Point | 410.1ºC |
| Exact Mass | 394.11600 |
| PSA | 132.80000 |
| LogP | 2.58200 |
| Index of Refraction | 1.688 |
| InChIKey | UEPLPNFSKRYEKO-HWAYABPNSA-N |
| SMILES | O=C(O)C=CC(=O)Nc1ccc(Cc2ccc(NC(=O)C=CC(=O)O)cc2)cc1 |
|
~%
(Z)-3-[[4-[[4-(... CAS#:6330-01-4 |
| Literature: Sarojini, T.; Ramachandraiah, A. Journal of the Indian Chemical Society, 1993 , vol. 70, # 2 p. 138 - 141 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|