Benzoic acid,5-[2-[4-[2-[4-[2-(2,4-diamino-5-methylphenyl)diazenyl]-3-methyl-2-sulfophenyl]diazenyl]phenyl]diazenyl]-2-hydroxy-,sodium salt (1:2) structure
|
Common Name | Benzoic acid,5-[2-[4-[2-[4-[2-(2,4-diamino-5-methylphenyl)diazenyl]-3-methyl-2-sulfophenyl]diazenyl]phenyl]diazenyl]-2-hydroxy-,sodium salt (1:2) | ||
|---|---|---|---|---|
| CAS Number | 6330-91-2 | Molecular Weight | 611.58400 | |
| Density | 1.54g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C27H24N8NaO6S+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[[4-[[4-[(2,4-diamino-5-methylphenyl)diazenyl]-3-methyl-2-sulfophenyl]diazenyl]phenyl]hydrazinylidene]-6-oxocyclohexa-1,4-diene-1-carboxylic acid |
|---|
| Density | 1.54g/cm3 |
|---|---|
| Molecular Formula | C27H24N8NaO6S+ |
| Molecular Weight | 611.58400 |
| Exact Mass | 611.14400 |
| PSA | 246.48000 |
| LogP | 9.60770 |
| Index of Refraction | 1.725 |
| InChIKey | VWFBJVZMOBJQJL-UHFFFAOYSA-N |
| SMILES | Cc1cc(N=Nc2ccc(N=Nc3ccc(N=Nc4ccc(O)c(C(=O)O)c4)cc3)c(S(=O)(=O)O)c2C)c(N)cc1N |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|