D-Mannitol,1,6-dibenzenesulfonate structure
|
Common Name | D-Mannitol,1,6-dibenzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 6331-08-4 | Molecular Weight | 462.49100 | |
| Density | 1.52g/cm3 | Boiling Point | 741.5ºC at 760 mmHg | |
| Molecular Formula | C18H22O10S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 402.2ºC | |
| Name | O1,O5-dibenzoyl-O2,O4-methanediyl-ribitol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 741.5ºC at 760 mmHg |
| Molecular Formula | C18H22O10S2 |
| Molecular Weight | 462.49100 |
| Flash Point | 402.2ºC |
| Exact Mass | 462.06500 |
| PSA | 184.42000 |
| LogP | 1.40260 |
| Index of Refraction | 1.616 |
| InChIKey | RNFVCBBGDQMRMN-UHFFFAOYSA-N |
| SMILES | O=S(=O)(OCC(O)C(O)C(O)C(O)COS(=O)(=O)c1ccccc1)c1ccccc1 |
|
~%
D-Mannitol,1,6-... CAS#:6331-08-4 |
| Literature: Skinner et al. Journal of the American Chemical Society, 1958 , vol. 80, p. 3788 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| O1,O6-Bis-benzolsulfonyl-D-mannit |
| O1,O6-bis-benzenesulfonyl-D-mannitol |
| O1,O5-Dibenzoyl-O2,O4-methandiyl-ribit |
| 1,5-di-O-benzoyl-2,4-O-methylidenepentitol |