1,1-bis(ethylsulfonyl)cyclopentane structure
|
Common Name | 1,1-bis(ethylsulfonyl)cyclopentane | ||
|---|---|---|---|---|
| CAS Number | 6331-13-1 | Molecular Weight | 254.36700 | |
| Density | 1.27g/cm3 | Boiling Point | 494.1ºC at 760 mmHg | |
| Molecular Formula | C9H18O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 329.1ºC | |
| Name | 1,1-bis(ethylsulfonyl)cyclopentane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.27g/cm3 |
|---|---|
| Boiling Point | 494.1ºC at 760 mmHg |
| Molecular Formula | C9H18O4S2 |
| Molecular Weight | 254.36700 |
| Flash Point | 329.1ºC |
| Exact Mass | 254.06500 |
| PSA | 85.04000 |
| LogP | 3.28770 |
| Index of Refraction | 1.508 |
| InChIKey | KAOVDLDUGLNQST-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)C1(S(=O)(=O)CC)CCCC1 |
|
~%
1,1-bis(ethylsu... CAS#:6331-13-1 |
| Literature: Cronyn Journal of the American Chemical Society, 1952 , vol. 74, p. 1225,1230 |
|
~%
1,1-bis(ethylsu... CAS#:6331-13-1 |
| Literature: Wallach; Borsche Chemische Berichte, 1898 , vol. 31, p. 338 |
|
~%
1,1-bis(ethylsu... CAS#:6331-13-1 |
| Literature: Wallach; Borsche Chemische Berichte, 1898 , vol. 31, p. 338 |
| 1,1-Bis-aethansulfonyl-cyclopentan |
| Cyclopentanonsulfonal |
| 1,1-bis-ethanesulfonyl-cyclopentane |
| 1.1-Bis-aethylsulfon-cyclopentan |