2-Amino-4,5-dichlorobenzenesulfonic acid structure
|
Common Name | 2-Amino-4,5-dichlorobenzenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 6331-96-0 | Molecular Weight | 242.080 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 270 °C(lit.) | |
| Molecular Formula | C6H5Cl2NO3S | Melting Point | 8-10 °C(lit.) | |
| MSDS | N/A | Flash Point | 270 °F | |
| Name | 2-Amino-4,5-dichlorobenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 270 °C(lit.) |
| Melting Point | 8-10 °C(lit.) |
| Molecular Formula | C6H5Cl2NO3S |
| Molecular Weight | 242.080 |
| Flash Point | 270 °F |
| Exact Mass | 240.936722 |
| PSA | 88.77000 |
| LogP | 2.29 |
| Vapour density | 7.4 (vs air) |
| Index of Refraction | 1.648 |
| InChIKey | AKLDPNVZTZIVFA-UHFFFAOYSA-N |
| SMILES | Nc1cc(Cl)c(Cl)cc1S(=O)(=O)O |
| Hazard Codes | Xn: Harmful; |
|---|---|
| Risk Phrases | R20/21/22 |
| Safety Phrases | S62 |
| WGK Germany | 3 |
| HS Code | 2921420090 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Benzenesulfonic acid, 2-amino-4,5-dichloro- |
| MFCD00036096 |
| 3,4-Dichloroaniline-6-sulfonic acid |
| 2-Amino-4,5-dichlorobenzenesulfonic acid |
| ZR CG DG FSWQ |