Benzenamine,4,4'-(1-propenylidene)bis[N,N-dimethyl- structure
|
Common Name | Benzenamine,4,4'-(1-propenylidene)bis[N,N-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 6332-03-2 | Molecular Weight | 280.40700 | |
| Density | 1.027g/cm3 | Boiling Point | 431.1ºC at 760mmHg | |
| Molecular Formula | C19H24N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.3ºC | |
| Name | 1,1-bis(4-dimethylaminophenyl)1-propene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.027g/cm3 |
|---|---|
| Boiling Point | 431.1ºC at 760mmHg |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.40700 |
| Flash Point | 194.3ºC |
| Exact Mass | 280.19400 |
| PSA | 6.48000 |
| LogP | 4.27020 |
| Index of Refraction | 1.603 |
| InChIKey | UDCAZMJSUNJNER-UHFFFAOYSA-N |
| SMILES | CC=C(c1ccc(N(C)C)cc1)c1ccc(N(C)C)cc1 |
|
~78%
Benzenamine,4,4... CAS#:6332-03-2 |
| Literature: Matsui, Masaki; Tsuge, Michinori; Shibata, Katsuyoshi; Muramatsu, Hiroshige Bulletin of the Chemical Society of Japan, 1994 , vol. 67, # 6 p. 1753 - 1755 |
|
~%
Benzenamine,4,4... CAS#:6332-03-2 |
| Literature: Skraup; Nieten Chemische Berichte, 1924 , vol. 57, p. 1303 |
|
~%
Benzenamine,4,4... CAS#:6332-03-2 |
| Literature: Lemoult Comptes Rendus Hebdomadaires des Seances de l'Academie des Sciences, 1913 , vol. 157, p. 724 |
|
~%
Detail
|
| Literature: Skraup; Nieten Chemische Berichte, 1924 , vol. 57, p. 1303 |
| Benzenamine,4,4'-(1,3-butadienylidene)bis[N,N-dimethyl |
| 1,1-bis(4-dimethylaminophenyl)propene |
| 1,1-Bis-(4-dimethylamino-phenyl)-propen |
| 1,1-Bis-<4-dimethylamino-phenyl>-butadien-(1,3) |
| 1.1-bis<p-(dimethylamino)phenyl>-2-methyl-ethylene |