methyl 3-[(2-carbamoylsulfanylacetyl)amino]-4-hydroxy-benzoate structure
|
Common Name | methyl 3-[(2-carbamoylsulfanylacetyl)amino]-4-hydroxy-benzoate | ||
|---|---|---|---|---|
| CAS Number | 6332-66-7 | Molecular Weight | 284.28800 | |
| Density | 1.495g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H12N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 3-[(2-carbamoylsulfanylacetyl)amino]-4-hydroxybenzoate |
|---|
| Density | 1.495g/cm3 |
|---|---|
| Molecular Formula | C11H12N2O5S |
| Molecular Weight | 284.28800 |
| Exact Mass | 284.04700 |
| PSA | 144.02000 |
| LogP | 1.70250 |
| Index of Refraction | 1.662 |
| InChIKey | KITKVLWHCPKKMU-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(O)c(NC(=O)CSC(N)=O)c1 |
|
~%
methyl 3-[(2-ca... CAS#:6332-66-7 |
| Literature: Weiss Journal of the American Chemical Society, 1947 , vol. 69, p. 2682 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |