phenyl-tetrakis(2,2,2-trifluoroethoxy)-λ5-phosphane structure
|
Common Name | phenyl-tetrakis(2,2,2-trifluoroethoxy)-λ5-phosphane | ||
|---|---|---|---|---|
| CAS Number | 63325-06-4 | Molecular Weight | 504.20500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13F12O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | phenyl-tetrakis(2,2,2-trifluoroethoxy)-λ5-phosphane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H13F12O4P |
|---|---|
| Molecular Weight | 504.20500 |
| Exact Mass | 504.03600 |
| PSA | 50.51000 |
| LogP | 5.84080 |
| InChIKey | IFNLQCCPUFMPSC-UHFFFAOYSA-N |
| SMILES | FC(F)(F)COP(OCC(F)(F)F)(OCC(F)(F)F)(OCC(F)(F)F)c1ccccc1 |
|
~82%
phenyl-tetrakis... CAS#:63325-06-4 |
| Literature: Denney,D.B.; Denney,D.Z.; Hammond,P.J. Journal of the American Chemical Society, 1981 , vol. 103, p. 1785 |
|
~%
phenyl-tetrakis... CAS#:63325-06-4 |
| Literature: Denney,D.B.; Denney,D.Z.; Hammond,P.J. Journal of the American Chemical Society, 1981 , vol. 103, p. 1785 |
| PHENYLTETRAKIS(2,2,2-TRIFLUOROETHOXY)PHOSPHORANE |
| phenyl-tetrakis(2,2,2-trifluoroethoxy) |