Hydrazinecarbothioamide,N-butyl-2-[(4-methoxyphenyl)methylene]- structure
|
Common Name | Hydrazinecarbothioamide,N-butyl-2-[(4-methoxyphenyl)methylene]- | ||
|---|---|---|---|---|
| CAS Number | 6334-22-1 | Molecular Weight | 265.37400 | |
| Density | 1.1g/cm3 | Boiling Point | 378.7ºC at 760 mmHg | |
| Molecular Formula | C13H19N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.8ºC | |
| Name | 1-butyl-3-[(4-methoxyphenyl)methylideneamino]thiourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1g/cm3 |
|---|---|
| Boiling Point | 378.7ºC at 760 mmHg |
| Molecular Formula | C13H19N3OS |
| Molecular Weight | 265.37400 |
| Flash Point | 182.8ºC |
| Exact Mass | 265.12500 |
| PSA | 77.74000 |
| LogP | 3.07510 |
| Index of Refraction | 1.555 |
| InChIKey | NYUIZBQLOMBDMI-XNTDXEJSSA-N |
| SMILES | CCCCNC(=S)NN=Cc1ccc(OC)cc1 |
| HS Code | 2930909090 |
|---|
|
~%
Hydrazinecarbot... CAS#:6334-22-1 |
| Literature: Bernstein et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 906,908 |
|
~%
Hydrazinecarbot... CAS#:6334-22-1 |
| Literature: Bernstein et al. Journal of the American Chemical Society, 1951 , vol. 73, p. 906,908 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Methoxy-benzaldehyd-(4-butyl-thiosemicarbazon) |
| 4-methoxy-benzaldehyde-(4-butyl thiosemicarbazone) |
| 3-butyl-1-[(4-methoxyphenyl)methylideneamino]thiourea |