Phenyl (p-nitrophenyl)acetate structure
|
Common Name | Phenyl (p-nitrophenyl)acetate | ||
|---|---|---|---|---|
| CAS Number | 6335-82-6 | Molecular Weight | 257.24100 | |
| Density | 1.288g/cm3 | Boiling Point | 428.1ºC at 760 mmHg | |
| Molecular Formula | C14H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.4ºC | |
| Name | Phenyl (p-nitrophenyl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.288g/cm3 |
|---|---|
| Boiling Point | 428.1ºC at 760 mmHg |
| Molecular Formula | C14H11NO4 |
| Molecular Weight | 257.24100 |
| Flash Point | 193.4ºC |
| Exact Mass | 257.06900 |
| PSA | 72.12000 |
| LogP | 3.26610 |
| Index of Refraction | 1.603 |
| InChIKey | VEGDDLOTBNPESF-UHFFFAOYSA-N |
| SMILES | O=C(Cc1ccc([N+](=O)[O-])cc1)Oc1ccccc1 |
| HS Code | 2916399090 |
|---|
|
~%
Phenyl (p-nitro... CAS#:6335-82-6 |
| Literature: Ward; Jenkins Journal of Organic Chemistry, 1945 , vol. 10, p. 371 |
|
~%
Phenyl (p-nitro... CAS#:6335-82-6 |
| Literature: Chandrasekar, Ramamurthy; Venkatasubramanian, Nagaswami Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1982 , p. 1625 - 1632 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| phenyl 4-nitrophenylacetate |
| 4-Nitrobenzeneacetic acid phenyl ester |
| p-Nitrophenylessigsaeure-phenylester |