6-methoxy-2-(4-methoxyphenyl)chroman-4-one structure
|
Common Name | 6-methoxy-2-(4-methoxyphenyl)chroman-4-one | ||
|---|---|---|---|---|
| CAS Number | 6336-07-8 | Molecular Weight | 284.30700 | |
| Density | 1.204g/cm3 | Boiling Point | 459ºC at 760 mmHg | |
| Molecular Formula | C17H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.8ºC | |
| Name | 6-methoxy-2-(4-methoxyphenyl)-2,3-dihydrochromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.204g/cm3 |
|---|---|
| Boiling Point | 459ºC at 760 mmHg |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.30700 |
| Flash Point | 204.8ºC |
| Exact Mass | 284.10500 |
| PSA | 44.76000 |
| LogP | 3.41030 |
| Index of Refraction | 1.574 |
| InChIKey | QGQFMHPTRWAWNG-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2CC(=O)c3cc(OC)ccc3O2)cc1 |
|
~79%
6-methoxy-2-(4-... CAS#:6336-07-8 |
| Literature: Aitmambetov; Dalimov; Kubzheterova Chemistry of Natural Compounds, 2001 , vol. 37, # 5 p. 421 - 423 |
|
~%
6-methoxy-2-(4-... CAS#:6336-07-8 |
| Literature: v. Kostanecki; Stoppani Chemische Berichte, 1904 , vol. 37, p. 782 |
|
~%
6-methoxy-2-(4-... CAS#:6336-07-8 |
| Literature: Vyas; Shah Journal of the Indian Chemical Society, 1951 , vol. 28, p. 75,78 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4',6-Dimethoxyflavanon |
| 6,4'-Dimethoxyflavanon |