1-Piperazinecarbothioamide,4-methyl-N-phenyl- structure
|
Common Name | 1-Piperazinecarbothioamide,4-methyl-N-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 6336-69-2 | Molecular Weight | 235.34800 | |
| Density | 1.206g/cm3 | Boiling Point | 335.3ºC at 760 mmHg | |
| Molecular Formula | C12H17N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.6ºC | |
| Name | 4-methyl-piperazine-1-carbodithioic acid methyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.206g/cm3 |
|---|---|
| Boiling Point | 335.3ºC at 760 mmHg |
| Molecular Formula | C12H17N3S |
| Molecular Weight | 235.34800 |
| Flash Point | 156.6ºC |
| Exact Mass | 235.11400 |
| PSA | 50.60000 |
| LogP | 1.57960 |
| Index of Refraction | 1.651 |
| InChIKey | XKZSVFMALMPFHB-UHFFFAOYSA-N |
| SMILES | CN1CCN(C(=S)Nc2ccccc2)CC1 |
| HS Code | 2933599090 |
|---|
|
~95%
1-Piperazinecar... CAS#:6336-69-2 |
| Literature: Abuzar, Syed; Sharma, Satyavan; Iyer, R. N. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1980 , vol. 19, # 3 p. 211 - 212 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Methyl-piperazin-1-dithiocarbonsaeure-methylester |
| 4-Methyl-piperazin-1-thiocarbonsaeure-anilid |
| 4-methyl-piperazine-1-carbothioic acid anilide |
| 1-methyl-4-methylsulfanylcarbothioylpiperazine |