5-[2-(4-hydroxyphenyl)ethyl]-2-methoxyphenol structure
|
Common Name | 5-[2-(4-hydroxyphenyl)ethyl]-2-methoxyphenol | ||
|---|---|---|---|---|
| CAS Number | 63367-94-2 | Molecular Weight | 244.28600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[2-(4-hydroxyphenyl)ethyl]-2-methoxyphenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H16O3 |
|---|---|
| Molecular Weight | 244.28600 |
| Exact Mass | 244.11000 |
| PSA | 49.69000 |
| LogP | 2.89160 |
| InChIKey | GUNRICIIRFLJKK-UHFFFAOYSA-N |
| SMILES | COc1ccc(CCc2ccc(O)cc2)cc1O |
|
~%
5-[2-(4-hydroxy... CAS#:63367-94-2 |
| Literature: Yamato; Sato; Hashigaki; Koyama Chemical and Pharmaceutical Bulletin, 1977 , vol. 25, # 4 p. 706 - 713 |
|
~%
5-[2-(4-hydroxy... CAS#:63367-94-2 |
| Literature: Yamato; Sato; Hashigaki; Koyama Chemical and Pharmaceutical Bulletin, 1977 , vol. 25, # 4 p. 706 - 713 |
| 4,3'-Dihydroxy-4'-methoxydibenzyl |
| 3,4'-dihydroxy-4-methoxydihydrostilbene |
| Phenol,5-[2-(4-hydroxyphenyl)ethyl]-2-methoxy |