1-methylamino-5-nitro-anthracene-9,10-dione structure
|
Common Name | 1-methylamino-5-nitro-anthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 6337-08-2 | Molecular Weight | 282.25100 | |
| Density | 1.482g/cm3 | Boiling Point | 544.5ºC at 760 mmHg | |
| Molecular Formula | C15H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 283.1ºC | |
| Name | 1-(methylamino)-5-nitroanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.482g/cm3 |
|---|---|
| Boiling Point | 544.5ºC at 760 mmHg |
| Molecular Formula | C15H10N2O4 |
| Molecular Weight | 282.25100 |
| Flash Point | 283.1ºC |
| Exact Mass | 282.06400 |
| PSA | 91.99000 |
| LogP | 3.00810 |
| Index of Refraction | 1.715 |
| InChIKey | AIECXCOELYPOFN-UHFFFAOYSA-N |
| SMILES | CNc1cccc2c1C(=O)c1cccc([N+](=O)[O-])c1C2=O |
|
~%
1-methylamino-5... CAS#:6337-08-2 |
| Literature: Bayer and Co. Patent: DE144634 ; |
|
~%
1-methylamino-5... CAS#:6337-08-2 |
| Literature: Hoechster Farbw. Patent: DE292395 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 13, p. 400 |
| 1-Methylamino-5-nitro-anthrachinon |
| 1-methylamino-5-nitro-anthraquinone |
| 1-Methylamino-5-nitro-9,10-anthraquinone |