9,10-Anthracenedione, 1-chloro-4-nitro- structure
|
Common Name | 9,10-Anthracenedione, 1-chloro-4-nitro- | ||
|---|---|---|---|---|
| CAS Number | 6337-82-2 | Molecular Weight | 287.65500 | |
| Density | 1.573g/cm3 | Boiling Point | 508.5ºC at 760 mmHg | |
| Molecular Formula | C14H6ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.3ºC | |
| Name | 1-chloro-4-nitroanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.573g/cm3 |
|---|---|
| Boiling Point | 508.5ºC at 760 mmHg |
| Molecular Formula | C14H6ClNO4 |
| Molecular Weight | 287.65500 |
| Flash Point | 261.3ºC |
| Exact Mass | 286.99900 |
| PSA | 79.96000 |
| LogP | 3.54680 |
| Index of Refraction | 1.692 |
| InChIKey | FLEURRNKVDUGOR-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)c2c([N+](=O)[O-])ccc(Cl)c21 |
|
~50%
9,10-Anthracene... CAS#:6337-82-2 |
| Literature: Tabatskaya; Beregovaya; Vlasov Russian Journal of Organic Chemistry, 1998 , vol. 34, # 6 p. 861 - 866 |
|
~%
9,10-Anthracene... CAS#:6337-82-2 |
| Literature: Kopetschni Patent: DE363930 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 14, p. 852 |
|
~%
9,10-Anthracene... CAS#:6337-82-2 |
| Literature: Kopetschni Patent: DE363930 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 14, p. 852 |
|
~%
9,10-Anthracene... CAS#:6337-82-2 |
| Literature: Kopetschni Patent: DE363930 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 14, p. 852 |
| Precursor 4 | |
|---|---|
| DownStream 5 | |
| 9,1-chloro-4-nitro |
| 4-nitro-1-chloroanthraquinone |
| Anthraquinone,1-chloro-4-nitro |
| 1-Nitro-4-chloroanthraquinone |
| 1-Chlor-4-nitro-anthrachinon |
| 1-Chloro-4-nitro-anthraquinone |