9,10-Anthracenedione,1-amino-4-chloro structure
|
Common Name | 9,10-Anthracenedione,1-amino-4-chloro | ||
|---|---|---|---|---|
| CAS Number | 2872-47-1 | Molecular Weight | 257.67200 | |
| Density | 1.486g/cm3 | Boiling Point | 500.9ºC at 760mmHg | |
| Molecular Formula | C14H8ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 256.7ºC | |
| Name | 1-amino-4-chloroanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.486g/cm3 |
|---|---|
| Boiling Point | 500.9ºC at 760mmHg |
| Molecular Formula | C14H8ClNO2 |
| Molecular Weight | 257.67200 |
| Flash Point | 256.7ºC |
| Exact Mass | 257.02400 |
| PSA | 60.16000 |
| LogP | 3.27880 |
| Vapour Pressure | 3.64E-10mmHg at 25°C |
| Index of Refraction | 1.711 |
| InChIKey | AWACQBFBMROGQC-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Cl)c2c1C(=O)c1ccccc1C2=O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| HS Code | 2922399090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 9 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: Small-molecule inhibitors of ST2 (IL1RL1)
Source: 20881
Target: interleukin-1 receptor-like 1 isoform [homo sapiens]
External Id: ST2_IL33_Inhibitors_Primary_Screening_77700
|
|
Name: Antagonist activity at human adenosine 2A receptor expressed in HEK293 cells assessed...
Source: ChEMBL
Target: Adenosine receptor A2a
External Id: CHEMBL1071497
|
|
Name: Inhibition of human adenosine 2A receptor at 1 mM
Source: ChEMBL
Target: Adenosine receptor A2a
External Id: CHEMBL1071496
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
|
Name: Inhibition of human adenosine 2A receptor
Source: ChEMBL
Target: Adenosine receptor A2a
External Id: CHEMBL1071493
|
| 1-Amino-4-chloro-9,10-anthracenedione |
| 1-Amino-4-chlor-anthrachinon |
| 4-Amino-4-chloroanthraquinone |
| ANTHRAQUINONE,1-AMINO-4-CHLORO |
| 1-amino-4-chloro-anthraquinone |
| 4-Chloro-1-aminoanthraquinone |