2-cyano-3-(5-nitro-2-furyl)-N-(1-phenylethyl)prop-2-enamide structure
|
Common Name | 2-cyano-3-(5-nitro-2-furyl)-N-(1-phenylethyl)prop-2-enamide | ||
|---|---|---|---|---|
| CAS Number | 6337-83-3 | Molecular Weight | 287.65500 | |
| Density | 1.323g/cm3 | Boiling Point | 554.5ºC at 760 mmHg | |
| Molecular Formula | C14H6ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 289.2ºC | |
| Name | 7-chloro-1-nitroanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.323g/cm3 |
|---|---|
| Boiling Point | 554.5ºC at 760 mmHg |
| Molecular Formula | C14H6ClNO4 |
| Molecular Weight | 287.65500 |
| Flash Point | 289.2ºC |
| Exact Mass | 286.99900 |
| PSA | 79.96000 |
| LogP | 3.54680 |
| Index of Refraction | 1.621 |
| InChIKey | VJHGOYHCKIQMQB-UHFFFAOYSA-N |
| SMILES | O=C1c2ccc(Cl)cc2C(=O)c2c1cccc2[N+](=O)[O-] |
|
~%
2-cyano-3-(5-ni... CAS#:6337-83-3 |
| Literature: Hashimoto,M. et al. Bulletin of the Chemical Society of Japan, 1974 , vol. 47, p. 1761 - 1766 |
|
~%
2-cyano-3-(5-ni... CAS#:6337-83-3 |
|
Literature: Dupont,R. Diss. |
| 7-Chlor-1-nitro-anthrachinon |
| 7-chloro-1-nitro-anthraquinone |
| 1-nitro-7-chloro-anthraquinone |
| 1-Nitro-7-chloroanthrachinon |