2-chloroanthraquinone structure
|
Common Name | 2-chloroanthraquinone | ||
|---|---|---|---|---|
| CAS Number | 131-09-9 | Molecular Weight | 242.657 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 425.7±34.0 °C at 760 mmHg | |
| Molecular Formula | C14H7ClO2 | Melting Point | 209-211 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 179.7±26.2 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-Chloroanthraquinone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 425.7±34.0 °C at 760 mmHg |
| Melting Point | 209-211 °C(lit.) |
| Molecular Formula | C14H7ClO2 |
| Molecular Weight | 242.657 |
| Flash Point | 179.7±26.2 °C |
| Exact Mass | 242.013458 |
| PSA | 34.14000 |
| LogP | 4.11 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.666 |
| InChIKey | FPKCTSIVDAWGFA-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)c2cc(Cl)ccc21 |
| Water Solubility | insoluble |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37;R43 |
| Safety Phrases | S26-S36-S37/39-S24 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 1 |
| RTECS | CB6151000 |
| HS Code | 2914700090 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
|
Photoreactivity of anthraquinones for the analysis of ginsenosides using photoreduction fluorescence detection-HPLC Park MK, et al.
Arch. Pharm. Res. 19(6) , 562-565, (1996)
|
| 2-Chloroanthracene-9,10-dione |
| 2-Chloro-9,10-anthraquinone |
| 9,10-Anthracenedione, 2-chloro- |
| MFCD00001227 |
| EINECS 205-010-0 |
| 2-chloroanthraquinone |