4-(benzenesulfonyl)-1-phenyl-butane-1,3-dione structure
|
Common Name | 4-(benzenesulfonyl)-1-phenyl-butane-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 6338-85-8 | Molecular Weight | 302.34500 | |
| Density | 1.274g/cm3 | Boiling Point | 510.5ºC at 760 mmHg | |
| Molecular Formula | C16H14O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 328.6ºC | |
| Name | 4-(benzenesulfonyl)-1-phenyl-butane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.274g/cm3 |
|---|---|
| Boiling Point | 510.5ºC at 760 mmHg |
| Molecular Formula | C16H14O4S |
| Molecular Weight | 302.34500 |
| Flash Point | 328.6ºC |
| Exact Mass | 302.06100 |
| PSA | 76.66000 |
| LogP | 3.38320 |
| Index of Refraction | 1.58 |
| InChIKey | GGERDNRGHCSHJP-UHFFFAOYSA-N |
| SMILES | O=C(CC(=O)c1ccccc1)CS(=O)(=O)c1ccccc1 |
|
~95%
4-(benzenesulfo... CAS#:6338-85-8 |
| Literature: Fargeas, Valerie; Baalouch, Myriam; Metay, Estelle; Baffreau, Jerome; Menard, Delphine; Gosselin, Pascal; Berge, Jean-Pascal; Barthomeuf, Chantal; Lebreton, Jacques Tetrahedron, 2004 , vol. 60, # 45 p. 10359 - 10364 |
|
~%
4-(benzenesulfo... CAS#:6338-85-8 |
| Literature: Fargeas, Valerie; Baalouch, Myriam; Metay, Estelle; Baffreau, Jerome; Menard, Delphine; Gosselin, Pascal; Berge, Jean-Pascal; Barthomeuf, Chantal; Lebreton, Jacques Tetrahedron, 2004 , vol. 60, # 45 p. 10359 - 10364 |
|
~%
4-(benzenesulfo... CAS#:6338-85-8 |
| Literature: Fargeas, Valerie; Baalouch, Myriam; Metay, Estelle; Baffreau, Jerome; Menard, Delphine; Gosselin, Pascal; Berge, Jean-Pascal; Barthomeuf, Chantal; Lebreton, Jacques Tetrahedron, 2004 , vol. 60, # 45 p. 10359 - 10364 |
|
~%
4-(benzenesulfo... CAS#:6338-85-8 |
| Literature: O'Sullivan,W.I. et al. Journal of the American Chemical Society, 1961 , vol. 83, p. 3453 - 3457 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Niometacinum |
| 4-Benzolsulfonyl-1-phenyl-butandion-(1.3) |
| Niometacine [INN-French] |
| 1-Benzolsulfonyl-4-phenyl-butan-2,4-dion |
| Niometacin |
| Niometacin [INN] |
| <1-Nicotinoyl-2-methyl-5-methoxy-indolyl-(3)>-essigsaeure |
| <1-Phenyl-1,3-dioxo-butyl>-phenyl-sulfon |
| Niometacina [Spanish] |
| (5-methoxy-2-methyl-1-nicotinoyl-indol-3-yl)-acetic acid |
| Niometacine [French] |
| Niometacina |
| Niometacinum [Latin] |
| 5-Methoxy-2-methyl-1-nicotinoyl-indol-3-yl-essigsaeure |
| 1-phenyl-4-phenylsulfonyl-1,3-butadione |
| Niometacine |