acetic acid,1-phenylpent-1-en-4-yn-3-ol structure
|
Common Name | acetic acid,1-phenylpent-1-en-4-yn-3-ol | ||
|---|---|---|---|---|
| CAS Number | 63399-81-5 | Molecular Weight | 218.24800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | acetic acid,1-phenylpent-1-en-4-yn-3-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H14O3 |
|---|---|
| Molecular Weight | 218.24800 |
| Exact Mass | 218.09400 |
| PSA | 57.53000 |
| LogP | 1.78480 |
| InChIKey | AAPPUIKZPCXHCS-UHFFFAOYSA-N |
| SMILES | C#CC(O)C=Cc1ccccc1.CC(=O)O |
|
~0%
acetic acid,1-p... CAS#:63399-81-5
Detail
|
| Literature: Burgess, Kevin; Jennings, Lee D. Journal of the American Chemical Society, 1990 , vol. 112, # 20 p. 7434 - 7435 |
| 1-Penten-4-yn-3-ol,1-phenyl-,acetate |