acetic acid,1-phenylhex-1-en-4-yn-3-ol structure
|
Common Name | acetic acid,1-phenylhex-1-en-4-yn-3-ol | ||
|---|---|---|---|---|
| CAS Number | 87639-27-8 | Molecular Weight | 232.27500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | acetic acid,1-phenylhex-1-en-4-yn-3-ol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H16O3 |
|---|---|
| Molecular Weight | 232.27500 |
| Exact Mass | 232.11000 |
| PSA | 57.53000 |
| LogP | 2.17490 |
| InChIKey | AYXADINQXZVJLE-UHFFFAOYSA-N |
| SMILES | CC#CC(O)C=Cc1ccccc1.CC(=O)O |
|
~%
acetic acid,1-p... CAS#:87639-27-8 |
| Literature: Keinan, Ehud; Peretz, Moshe Journal of Organic Chemistry, 1983 , vol. 48, # 26 p. 5302 - 5309 |
|
~%
acetic acid,1-p... CAS#:87639-27-8 |
| Literature: Keinan, Ehud; Peretz, Moshe Journal of Organic Chemistry, 1983 , vol. 48, # 26 p. 5302 - 5309 |
| Precursor 3 | |
|---|---|
| DownStream 7 | |
| 4-acetoxy-6-phenylhex-5-en-2-yne |
| 1-Hexen-4-yn-3-ol,1-phenyl-,acetate |