6-methyl-4-phenyl-1H-pyridin-2-one
Modify Date: 2025-09-14 00:32:02
6-methyl-4-phenyl-1H-pyridin-2-one structure
|
Common Name | 6-methyl-4-phenyl-1H-pyridin-2-one | ||
|---|---|---|---|---|
| CAS Number | 63404-83-1 | Molecular Weight | 185.22200 | |
| Density | 1.117g/cm3 | Boiling Point | 395.1ºC at 760 mmHg | |
| Molecular Formula | C12H11NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.6ºC | |
| Name | 6-methyl-4-phenyl-1H-pyridin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.117g/cm3 |
|---|---|
| Boiling Point | 395.1ºC at 760 mmHg |
| Molecular Formula | C12H11NO |
| Molecular Weight | 185.22200 |
| Flash Point | 234.6ºC |
| Exact Mass | 185.08400 |
| PSA | 33.12000 |
| LogP | 2.76260 |
| Index of Refraction | 1.576 |
| InChIKey | WHNNNJUVFOSIHL-UHFFFAOYSA-N |
| SMILES | Cc1cc(-c2ccccc2)cc(=O)[nH]1 |
| HS Code | 2933399090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:54453-92-8| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-methyl-4-phenylpyridin-2(1h)-one |
| 6-methyl-4-phenyl-2(1H)-pyridone |
| 6-methyl-4-phenyl-2-pyridone |
| 6-Methyl-4-phenyl-pyridon-(2) |
| 2-HYDROXY-6-METHYL-4-PHENYLPYRIDINE |
| 6-methyl-4-phenylpyridin-2-ol |