5-(Chloroacetyl)-8-(phenylmethoxy)-2(1H)-quinolinone
5-(Chloroacetyl)-8-(phenylmethoxy)-2(1H)-quinolinone structure
|
Common Name | 5-(Chloroacetyl)-8-(phenylmethoxy)-2(1H)-quinolinone | ||
|---|---|---|---|---|
| CAS Number | 63404-86-4 | Molecular Weight | 327.76200 | |
| Density | 1.312 g/cm3 | Boiling Point | 602.5ºC at 760 mmHg | |
| Molecular Formula | C18H14ClNO3 | Melting Point | 205.5°C | |
| MSDS | N/A | Flash Point | 318.2ºC | |
Summary: 5-(2-Chloroacetyl)-8-phenylmethoxy-1H-quinolin-2-one (Chinese name: 5-氯乙酰基-8-苄氧基-2(1H)-喹啉酮)， CAS number: 63404-86-4，molecular formula: C18H14ClNO3，molecular weight: 327.76200，for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(2-chloroacetyl)-8-phenylmethoxy-1H-quinolin-2-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.312 g/cm3 |
|---|---|
| Boiling Point | 602.5ºC at 760 mmHg |
| Melting Point | 205.5°C |
| Molecular Formula | C18H14ClNO3 |
| Molecular Weight | 327.76200 |
| Flash Point | 318.2ºC |
| Exact Mass | 327.06600 |
| PSA | 59.42000 |
| LogP | 3.94090 |
| InChIKey | AUFKEUKWVZCLQD-UHFFFAOYSA-N |
| SMILES | O=C(CCl)c1ccc(OCc2ccccc2)c2[nH]c(=O)ccc12 |
| Storage condition | 2-8°C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933790090 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~83%
5-(Chloroacetyl... CAS#:63404-86-4 |
| Literature: Boehringer Ingelheim International GmbH Patent: US2005/277632 A1, 2005 ; Location in patent: Page/Page column 10 ; |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2933790090 |
|---|---|
| Summary | 2933790090. other lactams. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:9.0%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 8-benzyloxy-5-chloroacetylcarbostyril |
| 8-benzyloxy-5-chloroacetyl-1H-quinolin-2-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 5-(2-chloroacetyl)-8-phenylmethoxy-1H-quinolin-2-one? |
| A: Molecular weight of 5-(2-chloroacetyl)-8-phenylmethoxy-1H-quinolin-2-one is 327.76200. |
| Q: What is the boiling point of 5-(2-chloroacetyl)-8-phenylmethoxy-1H-quinolin-2-one? |
| A: Boiling point of 5-(2-chloroacetyl)-8-phenylmethoxy-1H-quinolin-2-one is 602.5ºC at 760 mmHg. |
| Q: What is the SMILES notation of 5-(2-chloroacetyl)-8-phenylmethoxy-1H-quinolin-2-one? |
| A: SMILES notation of 5-(2-chloroacetyl)-8-phenylmethoxy-1H-quinolin-2-one is O=C(CCl)c1ccc(OCc2ccccc2)c2[nH]c(=O)ccc12. |
| Q: What are the storage conditions for 5-(2-chloroacetyl)-8-phenylmethoxy-1H-quinolin-2-one? |
| A: Storage conditions for 5-(2-chloroacetyl)-8-phenylmethoxy-1H-quinolin-2-one: 2-8°C. |
| Q: What is the InChIKey of 5-(2-chloroacetyl)-8-phenylmethoxy-1H-quinolin-2-one? |
| A: InChIKey of 5-(2-chloroacetyl)-8-phenylmethoxy-1H-quinolin-2-one is AUFKEUKWVZCLQD-UHFFFAOYSA-N. |
| Q: What is the CAS number of 5-(2-chloroacetyl)-8-phenylmethoxy-1H-quinolin-2-one? |
| A: CAS number of 5-(2-chloroacetyl)-8-phenylmethoxy-1H-quinolin-2-one is 63404-86-4. |
| Q: What English synonyms does 5-(2-chloroacetyl)-8-phenylmethoxy-1H-quinolin-2-one have? |
| A: English synonyms of 5-(2-chloroacetyl)-8-phenylmethoxy-1H-quinolin-2-one: 8-benzyloxy-5-chloroacetylcarbostyril, 8-benzyloxy-5-chloroacetyl-1H-quinolin-2-one. |
| Q: What is the melting point of 5-(2-chloroacetyl)-8-phenylmethoxy-1H-quinolin-2-one? |
| A: Melting point of 5-(2-chloroacetyl)-8-phenylmethoxy-1H-quinolin-2-one is 205.5°C. |
| Q: What is the molecular formula of 5-(2-chloroacetyl)-8-phenylmethoxy-1H-quinolin-2-one? |
| A: Molecular formula of 5-(2-chloroacetyl)-8-phenylmethoxy-1H-quinolin-2-one is C18H14ClNO3. |
| Q: What is the LogP of 5-(2-chloroacetyl)-8-phenylmethoxy-1H-quinolin-2-one? |
| A: LogP of 5-(2-chloroacetyl)-8-phenylmethoxy-1H-quinolin-2-one is 3.94090. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |