Propanedioic acid,2-(1-naphthalenyl)- structure
|
Common Name | Propanedioic acid,2-(1-naphthalenyl)- | ||
|---|---|---|---|---|
| CAS Number | 6341-57-7 | Molecular Weight | 230.21600 | |
| Density | 1.413g/cm3 | Boiling Point | 463.8ºC at 760 mmHg | |
| Molecular Formula | C13H10O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.4ºC | |
| Name | 2-naphthalen-1-ylpropanedioic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.413g/cm3 |
|---|---|
| Boiling Point | 463.8ºC at 760 mmHg |
| Molecular Formula | C13H10O4 |
| Molecular Weight | 230.21600 |
| Flash Point | 248.4ºC |
| Exact Mass | 230.05800 |
| PSA | 74.60000 |
| LogP | 2.09260 |
| Index of Refraction | 1.678 |
| InChIKey | MTWVMHFXOXGTCR-UHFFFAOYSA-N |
| SMILES | O=C(O)C(C(=O)O)c1cccc2ccccc12 |
| HS Code | 2917399090 |
|---|
|
~%
Propanedioic ac... CAS#:6341-57-7 |
| Literature: Iwanow et al. Doklady Bolgarskoi Akademii Nauk, 1954 , vol. 7, # 3 p. 33 Godisnik Univ. Sofia, 52 Chimija <1957/58> 1, 25 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-Naphthalen-1-yl-malonic acid |
| 1-Naphthalenemalonic acid |
| naphthalen-1-ylpropanedioic acid |