diethyl 2-naphthalen-1-ylpropanedioate structure
|
Common Name | diethyl 2-naphthalen-1-ylpropanedioate | ||
|---|---|---|---|---|
| CAS Number | 6341-60-2 | Molecular Weight | 286.32200 | |
| Density | 1.161g/cm3 | Boiling Point | 394.1ºC at 760 mmHg | |
| Molecular Formula | C17H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.4ºC | |
| Name | diethyl 2-naphthalen-1-ylpropanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.161g/cm3 |
|---|---|
| Boiling Point | 394.1ºC at 760 mmHg |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.32200 |
| Flash Point | 193.4ºC |
| Exact Mass | 286.12100 |
| PSA | 52.60000 |
| LogP | 3.04960 |
| Index of Refraction | 1.565 |
| InChIKey | BWBVCAXBRMQDJU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)OCC)c1cccc2ccccc12 |
| HS Code | 2917399090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| diethyl 2-(naphthalen-1-yl)propanedioate |
| diethyl 2-(1-naphthyl)malonate |
| diethyl (1-naphthyl)malonate |
| naphthalen-1-yl-malonic acid diethyl ester |
| Diethyl 2-(naphthalen-1-yl)malonate |
| 2-naphthalen-1-yl-malonic acid diethyl ester |
| diethyl naphthalen-1-ylpropanedioate |