(2R)-2-[(4-Ethyl-2,3-dioxopiperazinyl)carbonylamino]-2-phenylacetic acid structure
|
Common Name | (2R)-2-[(4-Ethyl-2,3-dioxopiperazinyl)carbonylamino]-2-phenylacetic acid | ||
|---|---|---|---|---|
| CAS Number | 63422-71-9 | Molecular Weight | 319.31300 | |
| Density | 1.377 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C15H17N3O5 | Melting Point | 171 °C (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (R)-(-)-α-[[(4-Ethyl-2,3-dioxo-1-piperazinyl)carbonyl]amino]benzeneacetic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.377 g/cm3 |
|---|---|
| Melting Point | 171 °C (dec.)(lit.) |
| Molecular Formula | C15H17N3O5 |
| Molecular Weight | 319.31300 |
| Exact Mass | 319.11700 |
| PSA | 107.02000 |
| LogP | 0.47930 |
| InChIKey | JQEHQELQPPKXRR-LLVKDONJSA-N |
| SMILES | CCN1CCN(C(=O)NC(C(=O)O)c2ccccc2)C(=O)C1=O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933599090 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (2R)-2-[(4-ethyl-2,3-dioxopiperazine-1-carbonyl)amino]-2-phenylacetic acid |
| MFCD00799536 |
| EINECS 264-133-8 |
| D-(-)-A-[[(4-ETHYL-2,3-DIOXO-1-PIPERAZINYL)CARBONYL]AMINO] BENZENEACETIC ACID |
| EPCP |
| (2R)-2-[(4-Ethyl-2,3-dioxopiperazinyl)carbonylamino]-2-phenylacetic acid |
| Piperacillin Impurity 7 |