2-Chloro-1,3-bis(trifluoromethyl)benzene structure
|
Common Name | 2-Chloro-1,3-bis(trifluoromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 63430-02-4 | Molecular Weight | 248.553 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 157.3±35.0 °C at 760 mmHg | |
| Molecular Formula | C8H3ClF6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 60.8±19.4 °C | |
| Name | 2-chloro-1,3-bis(trifluoromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 157.3±35.0 °C at 760 mmHg |
| Molecular Formula | C8H3ClF6 |
| Molecular Weight | 248.553 |
| Flash Point | 60.8±19.4 °C |
| Exact Mass | 247.982742 |
| LogP | 4.52 |
| Vapour Pressure | 3.6±0.3 mmHg at 25°C |
| Index of Refraction | 1.403 |
| InChIKey | QULONSINRUUAHY-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cccc(C(F)(F)F)c1Cl |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2903999090 |
|
~%
2-Chloro-1,3-bi... CAS#:63430-02-4 |
| Literature: US2005712 , ; |
|
~%
2-Chloro-1,3-bi... CAS#:63430-02-4 |
| Literature: US2005712 , ; |
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2-chloro-1,3-bis-(trifluoromethyl)-benzene |
| 2,6-Bis(trifluoromethyl)chlorobenzene |
| Benzene, 2-chloro-1,3-bis(trifluoromethyl)- |
| 2-Chlor-1,3-bis-trifluormethyl-benzol |
| 1-chloro-2,6-bis(trifluoromethyl)benzene |
| 2-Chloro-1,3-bis(trifluoromethyl)benzene |
| PC2246 |
| 2,5 DIFLUOROBENZYL CHLORIDE |