2-(2-methoxyethoxy)ethyl 3-bromobenzoate
Modify Date: 2025-09-16 10:44:20
2-(2-methoxyethoxy)ethyl 3-bromobenzoate structure
|
Common Name | 2-(2-methoxyethoxy)ethyl 3-bromobenzoate | ||
|---|---|---|---|---|
| CAS Number | 6344-32-7 | Molecular Weight | 303.14900 | |
| Density | 1.363g/cm3 | Boiling Point | 332.1ºC at 760 mmHg | |
| Molecular Formula | C12H15BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 154.7ºC | |
| Name | 2-(2-methoxyethoxy)ethyl 3-bromobenzoate |
|---|
| Density | 1.363g/cm3 |
|---|---|
| Boiling Point | 332.1ºC at 760 mmHg |
| Molecular Formula | C12H15BrO4 |
| Molecular Weight | 303.14900 |
| Flash Point | 154.7ºC |
| Exact Mass | 302.01500 |
| PSA | 44.76000 |
| LogP | 2.26890 |
| Index of Refraction | 1.521 |
| InChIKey | JMKPQGJCVUBCOL-UHFFFAOYSA-N |
| SMILES | COCCOCCOC(=O)c1cccc(Br)c1 |
|
~%
2-(2-methoxyeth... CAS#:6344-32-7 |
| Literature: Suk, Jae-Min; Jeong, Kyu-Sung Journal of the American Chemical Society, 2008 , vol. 130, # 36 p. 11868 - 11869 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |