N-[4-(4-acetamidophenyl)sulfonylphenyl]propanamide structure
|
Common Name | N-[4-(4-acetamidophenyl)sulfonylphenyl]propanamide | ||
|---|---|---|---|---|
| CAS Number | 6345-91-1 | Molecular Weight | 346.40100 | |
| Density | 1.329g/cm3 | Boiling Point | 661.6ºC at 760 mmHg | |
| Molecular Formula | C17H18N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 353.9ºC | |
| Name | N-(4-{[4-(acetylamino)phenyl]sulfonyl}phenyl)propanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.329g/cm3 |
|---|---|
| Boiling Point | 661.6ºC at 760 mmHg |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.40100 |
| Flash Point | 353.9ºC |
| Exact Mass | 346.09900 |
| PSA | 100.72000 |
| LogP | 4.05310 |
| Index of Refraction | 1.615 |
| InChIKey | BXRAQJKFWLWIEC-UHFFFAOYSA-N |
| SMILES | CCC(=O)Nc1ccc(S(=O)(=O)c2ccc(NC(C)=O)cc2)cc1 |
|
~%
N-[4-(4-acetami... CAS#:6345-91-1 |
| Literature: Shonle; Van Arendonk Journal of the American Chemical Society, 1943 , vol. 65, p. 2375 |
|
~%
N-[4-(4-acetami... CAS#:6345-91-1 |
| Literature: Shonle; Van Arendonk Journal of the American Chemical Society, 1943 , vol. 65, p. 2375 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| (4-Acetamino-phenyl)-(4-propionylamino-phenyl)-sulfon |
| Propionsaeure-[4-(4-acetamino-phenylsulfon)-anilid] |
| 4-Acetylamino-4'-propionylaminodiphenyl sulfone |
| Propionanilide,4'-((p-acetamidophenyl)sulfonyl) |
| (4-acetylamino-phenyl)-(4-propionylamino-phenyl)-sulfone |
| 4-(N-Acetyl-sulfanilyl)-propionsaeure-anilid |
| N-(4-((4-(Acetylamino)phenyl)sulfonyl)phenyl)propanamide |
| N-[4-(4-acetamidophenyl)sulfonylphenyl]propanamide |