3-[[4-[(2,6-dichloro-4-nitrophenyl)azo]-3-methylphenyl]ethylamino]propiononitrile structure
|
Common Name | 3-[[4-[(2,6-dichloro-4-nitrophenyl)azo]-3-methylphenyl]ethylamino]propiononitrile | ||
|---|---|---|---|---|
| CAS Number | 63467-11-8 | Molecular Weight | 406.26600 | |
| Density | 1.33g/cm3 | Boiling Point | 612.7ºC at 760 mmHg | |
| Molecular Formula | C18H17Cl2N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 324.4ºC | |
| Name | 3-[4-[(2,6-dichloro-4-nitrophenyl)diazenyl]-N-ethyl-3-methylanilino]propanenitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 612.7ºC at 760 mmHg |
| Molecular Formula | C18H17Cl2N5O2 |
| Molecular Weight | 406.26600 |
| Flash Point | 324.4ºC |
| Exact Mass | 405.07600 |
| PSA | 97.57000 |
| LogP | 6.88858 |
| Index of Refraction | 1.619 |
| InChIKey | GXWKYWHBRDHRFJ-UHFFFAOYSA-N |
| SMILES | CCN(CCC#N)c1ccc(N=Nc2c(Cl)cc([N+](=O)[O-])cc2Cl)c(C)c1 |
|
~%
3-[[4-[(2,6-dic... CAS#:63467-11-8 |
| Literature: DyStar Textilfarben GmbH and Co. Deutschland KG Patent: US6682573 B2, 2004 ; Location in patent: Page column 12-13 ; |
|
~%
3-[[4-[(2,6-dic... CAS#:63467-11-8 |
| Literature: DyStar Textilfarben GmbH and Co. Deutschland KG Patent: EP1188799 A1, 2002 ; Location in patent: Example 2 ; |
| 3-((4-((2,6-Dichloro-4-nitrophenyl)azo)-3-methylphenyl)ethylamino)propanenitrile |
| 3-(4-((2,6-Dichloro-4-nitrophenyl)azo)-N-ethyl-m-toluidino)propionitrile |
| 3-({4-[(2,6-dichloro-4-nitrophenyl)azo]-3-methylphenyl}ethylamino)propiononitrile |
| EINECS 264-224-2 |