2,2,6,6-tetramethylpiperidone-4 oxime hydrochloride
Modify Date: 2025-08-25 13:23:01
2,2,6,6-tetramethylpiperidone-4 oxime hydrochloride structure
|
Common Name | 2,2,6,6-tetramethylpiperidone-4 oxime hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 63467-53-8 | Molecular Weight | 206.71300 | |
| Density | N/A | Boiling Point | 253.1ºC at 760 mmHg | |
| Molecular Formula | C9H19ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 106.9ºC | |
| Name | 2,2,6,6-tetramethylpiperidone-4 oxime hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 253.1ºC at 760 mmHg |
|---|---|
| Molecular Formula | C9H19ClN2O |
| Molecular Weight | 206.71300 |
| Flash Point | 106.9ºC |
| Exact Mass | 206.11900 |
| PSA | 44.62000 |
| LogP | 2.88800 |
| InChIKey | PMDFGKBTEGXYED-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(=NO)CC(C)(C)N1.Cl |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2933399090 |
|
~57%
2,2,6,6-tetrame... CAS#:63467-53-8 |
| Literature: Glowacka; Szczepek; Wrona Polish Journal of Chemistry, 2000 , vol. 74, # 9 p. 1341 - 1348 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-hydroxyimino-2,2,6,6-tetramethylpiperidine hydrochloride |
| 2,2,6,6-tetramethyl-piperidin-4-one oxime,hydrochloride |
| TMP=NOH |
| 2,2,6,6-Tetramethyl-piperidin-4-on-oxim,Hydrochlorid |
| TEMPOXIME |