4-O-(2-ethylhexyl) 1-O-methyl benzene-1,4-dicarboxylate structure
|
Common Name | 4-O-(2-ethylhexyl) 1-O-methyl benzene-1,4-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 63468-13-3 | Molecular Weight | 292.37000 | |
| Density | 1.039g/cm3 | Boiling Point | 331.8ºC at 760 mmHg | |
| Molecular Formula | C17H24O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.5ºC | |
| Name | 4-O-(2-ethylhexyl) 1-O-methyl benzene-1,4-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.039g/cm3 |
|---|---|
| Boiling Point | 331.8ºC at 760 mmHg |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.37000 |
| Flash Point | 174.5ºC |
| Exact Mass | 292.16700 |
| PSA | 52.60000 |
| LogP | 3.84640 |
| Index of Refraction | 1.496 |
| InChIKey | KHDNBLKBTBOSDJ-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COC(=O)c1ccc(C(=O)OC)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2917399090 |
|
~99%
4-O-(2-ethylhex... CAS#:63468-13-3 |
| Literature: Barry, Jean; Bram, Georges; Petit, Alain Tetrahedron Letters, 1988 , vol. 29, # 36 p. 4567 - 4568 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| EINECS 264-249-9 |
| 1,4-Benzenedicarboxylicacid,2-ethylhexyl methyl ester (9CI) |
| 2-Ethylhexyl methyl terephthalate |
| 1,4-Benzenedicarboxylicacid,1-(2-ethylhexyl) 4-methyl ester |