1, 4-Diaminonaphthalene-6-sulfonic acid
1, 4-Diaminonaphthalene-6-sulfonic acid structure
|
Common Name | 1, 4-Diaminonaphthalene-6-sulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 6357-90-0 | Molecular Weight | 238.26300 | |
| Density | 1.579g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H10N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5,8-diaminonaphthalene-2-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.579g/cm3 |
|---|---|
| Molecular Formula | C10H10N2O3S |
| Molecular Weight | 238.26300 |
| Exact Mass | 238.04100 |
| PSA | 114.79000 |
| LogP | 3.49410 |
| Index of Refraction | 1.756 |
| InChIKey | XEQRJJADVVXFHB-UHFFFAOYSA-N |
| SMILES | Nc1ccc(N)c2cc(S(=O)(=O)O)ccc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1, 4-Diaminonap... CAS#:6357-90-0 |
| Literature: Dahl and Co. Patent: DE66354 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 3, p. 499 |
|
~%
1, 4-Diaminonap... CAS#:6357-90-0 |
|
Literature: Wegmann,M. Diss. |
|
~%
1, 4-Diaminonap... CAS#:6357-90-0 |
|
Literature: Wegmann,M. Diss. |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 4 | |
|---|---|
| DownStream 1 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,4-diamino-naphthalene-6-sulphonic acid |
| 1,4-Diamino-6-naphthalenesulfonic acid |
| 5,8-diamino-naphthalene-2-sulfonic acid |
| 5,8-Diamino-naphthalin-2-sulfonsaeure |
| 1,4-Diaminonaphthalene-6-sulfonic acid |
| Naphthylendiamin-(1.4)-sulfonsaeure-(6) |
| 2-Naphthalenesulfonic acid,8-diamino |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 5,8-diaminonaphthalene-2-sulfonic acid? |
| A: InChIKey of 5,8-diaminonaphthalene-2-sulfonic acid is XEQRJJADVVXFHB-UHFFFAOYSA-N. |
| Q: What is the CAS number of 5,8-diaminonaphthalene-2-sulfonic acid? |
| A: CAS number of 5,8-diaminonaphthalene-2-sulfonic acid is 6357-90-0. |
| Q: What is the English name of 5,8-diaminonaphthalene-2-sulfonic acid? |
| A: The English name of 5,8-diaminonaphthalene-2-sulfonic acid is 5,8-diaminonaphthalene-2-sulfonic acid. |
| Q: What is the Chinese name of 6357-90-0? |
| A: Chinese name of 6357-90-0 is 6357-90-0. |
| Q: What are the downstream products of 5,8-diaminonaphthalene-2-sulfonic acid? |
| A: Related downstream products(CAS) of 5,8-diaminonaphthalene-2-sulfonic acid: 85-76-7. |
| Q: What is the SMILES notation of 5,8-diaminonaphthalene-2-sulfonic acid? |
| A: SMILES notation of 5,8-diaminonaphthalene-2-sulfonic acid is Nc1ccc(N)c2cc(S(=O)(=O)O)ccc12. |
| Q: What is the molecular formula of 5,8-diaminonaphthalene-2-sulfonic acid? |
| A: Molecular formula of 5,8-diaminonaphthalene-2-sulfonic acid is C10H10N2O3S. |
| Q: What is the LogP of 5,8-diaminonaphthalene-2-sulfonic acid? |
| A: LogP of 5,8-diaminonaphthalene-2-sulfonic acid is 3.49410. |
| Q: What is the polar surface area (PSA) of 5,8-diaminonaphthalene-2-sulfonic acid? |
| A: Polar surface area (PSA) of 5,8-diaminonaphthalene-2-sulfonic acid is 114.79000. |
| Q: What English synonyms does 5,8-diaminonaphthalene-2-sulfonic acid have? |
| A: English synonyms of 5,8-diaminonaphthalene-2-sulfonic acid: 1,4-diamino-naphthalene-6-sulphonic acid, 1,4-Diamino-6-naphthalenesulfonic acid, 5,8-diamino-naphthalene-2-sulfonic acid, 5,8-Diamino-naphthalin-2-sulfonsaeure, 1,4-Diaminonaphthalene-6-sulfonic acid, Naphthylendiamin-(1.4)-sulfonsaeure-(6), 2-Naphthalenesulfonic acid,8-diamino. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |