2-Naphthalenesulfonicacid, 8-(acetylamino)-5-amino structure
|
Common Name | 2-Naphthalenesulfonicacid, 8-(acetylamino)-5-amino | ||
|---|---|---|---|---|
| CAS Number | 85-76-7 | Molecular Weight | 280.30000 | |
| Density | 1.542g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H12N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-acetamido-5-aminonaphthalene-2-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.542g/cm3 |
|---|---|
| Molecular Formula | C12H12N2O4S |
| Molecular Weight | 280.30000 |
| Exact Mass | 280.05200 |
| PSA | 117.87000 |
| LogP | 3.36210 |
| Index of Refraction | 1.713 |
| InChIKey | SDZUJERWLPSKII-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(N)c2ccc(S(=O)(=O)O)cc12 |
| HS Code | 2924299090 |
|---|
|
~%
2-Naphthalenesu... CAS#:85-76-7 |
| Literature: Bayer and Co. Patent: DE109609 ; |
|
~%
2-Naphthalenesu... CAS#:85-76-7 |
| Literature: Cassella and Co. Patent: DE116922 ; |
|
~%
2-Naphthalenesu... CAS#:85-76-7 |
| Literature: Cassella and Co. Patent: DE74177 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 3, p. 499 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-amino-4-acetamino-naphthalene-6-sulphonic acid |
| Acetylamino Cleve's acid |
| 8-Acetylamino-5-amino-naphthalin-2-sulfonsaeure |
| 2-Naphthalenesulfonic acid,8-acetamido-5-amino |
| 8-acetylamino-5-amino-naphthalene-2-sulfonic acid |