N-(3-amino-2-hydroxy-5-nitrophenyl)acetamide
Modify Date: 2026-06-30 20:59:46
N-(3-amino-2-hydroxy-5-nitrophenyl)acetamide structure
|
Common Name | N-(3-amino-2-hydroxy-5-nitrophenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 6358-63-0 | Molecular Weight | 211.17500 | |
| Density | 1.563g/cm3 | Boiling Point | 480.5ºC at 760 mmHg | |
| Molecular Formula | C8H9N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.4ºC | |
| Name | N-(3-amino-2-hydroxy-5-nitrophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.563g/cm3 |
|---|---|
| Boiling Point | 480.5ºC at 760 mmHg |
| Molecular Formula | C8H9N3O4 |
| Molecular Weight | 211.17500 |
| Flash Point | 244.4ºC |
| Exact Mass | 211.05900 |
| PSA | 121.17000 |
| LogP | 2.01840 |
| Index of Refraction | 1.717 |
| InChIKey | JBYMSNCIQHSWOD-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cc([N+](=O)[O-])cc(N)c1O |
| HS Code | 2924299090 |
|---|
|
~%
N-(3-amino-2-hy... CAS#:6358-63-0 |
| Literature: Cassella and Co. Patent: DE161341 ; |
|
~%
N-(3-amino-2-hy... CAS#:6358-63-0 |
| Literature: Cassella and Co. Patent: DE161341 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| acetic acid-(3-amino-2-hydroxy-5-nitro-anilide) |
| EINECS 228-781-5 |
| 4-Nitro-2-amino-6-acetamino-phenol |
| Essigsaeure-(3-amino-2-hydroxy-5-nitro-anilid) |
| Acetamide,N-(3-amino-2-hydroxy-5-nitrophenyl) |