Acetamide,N-(2-hydroxy-3,5-dinitrophenyl) structure
|
Common Name | Acetamide,N-(2-hydroxy-3,5-dinitrophenyl) | ||
|---|---|---|---|---|
| CAS Number | 5422-72-0 | Molecular Weight | 241.15800 | |
| Density | 1.667g/cm3 | Boiling Point | 414.2ºC at 760mmHg | |
| Molecular Formula | C8H7N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 204.3ºC | |
| Name | N-(2-hydroxy-3,5-dinitrophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.667g/cm3 |
|---|---|
| Boiling Point | 414.2ºC at 760mmHg |
| Molecular Formula | C8H7N3O6 |
| Molecular Weight | 241.15800 |
| Flash Point | 204.3ºC |
| Exact Mass | 241.03300 |
| PSA | 140.97000 |
| LogP | 2.28640 |
| Index of Refraction | 1.693 |
| InChIKey | RMWYWQJCJOEMTR-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O |
| HS Code | 2924299090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| acetic acid-(2-hydroxy-3,5-dinitro-anilide) |
| Acetamide,5-dinitrophenyl) |
| Essigsaeure-(2-hydroxy-3,5-dinitro-anilid) |
| Acetamide,N-(3,5-dinitro-2-hydroxyphenyl) |
| Acetamide,N-(2-hydroxy-3,5-dinitrophenyl) |
| 3',5'-Dinitro-2'-hydroxyacetanilide |
| N-Acetyl-pikraminsaeure |
| 3',5'-Dinitro-2'-hydroxyacetaniline |
| 4.6-Dinitro-2-acetamino-phenol |
| Acetanilide,5'-dinitro |