Methyl 3-amino-4-chloro-5-methoxybenzenecarboxylate structure
|
Common Name | Methyl 3-amino-4-chloro-5-methoxybenzenecarboxylate | ||
|---|---|---|---|---|
| CAS Number | 63603-10-1 | Molecular Weight | 215.63400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 3-amino-4-chloro-5-methoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H10ClNO3 |
|---|---|
| Molecular Weight | 215.63400 |
| Exact Mass | 215.03500 |
| PSA | 61.55000 |
| LogP | 2.29860 |
| InChIKey | XUOMUTYNGPAHPH-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc(N)c(Cl)c(OC)c1 |
| HS Code | 2922509090 |
|---|
|
~99%
Methyl 3-amino-... CAS#:63603-10-1 |
| Literature: KING'S COLLEGE LONDON Patent: US2012/149737 A1, 2012 ; Location in patent: Page/Page column 89 ; |
|
~%
Methyl 3-amino-... CAS#:63603-10-1 |
| Literature: WO2011/27106 A1, ; WO 2011/027106 A1 |
|
~%
Methyl 3-amino-... CAS#:63603-10-1 |
| Literature: WO2011/27106 A1, ; WO 2011/027106 A1 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| methyl 4-chloro-3-methoxy-5-aminobenzoate |