5-amino-2-hydroxy-3-nitrobenzenesulphonic acid structure
|
Common Name | 5-amino-2-hydroxy-3-nitrobenzenesulphonic acid | ||
|---|---|---|---|---|
| CAS Number | 6362-52-3 | Molecular Weight | 234.18700 | |
| Density | 1.877g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C6H6N2O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-amino-2-hydroxy-3-nitrobenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.877g/cm3 |
|---|---|
| Molecular Formula | C6H6N2O6S |
| Molecular Weight | 234.18700 |
| Exact Mass | 233.99500 |
| PSA | 154.82000 |
| LogP | 2.31450 |
| Index of Refraction | 1.701 |
| InChIKey | WKPCPXPNQFUCHH-UHFFFAOYSA-N |
| SMILES | Nc1cc([N+](=O)[O-])c(O)c(S(=O)(=O)O)c1 |
| HS Code | 2922299090 |
|---|
|
~%
5-amino-2-hydro... CAS#:6362-52-3 |
| Literature: Riegel; Post; Reid Journal of the American Chemical Society, 1929 , vol. 51, p. 508 |
|
~%
5-amino-2-hydro... CAS#:6362-52-3 |
| Literature: Bad. Anilin- u. Sodaf. Patent: DE113337 ; |
|
~%
5-amino-2-hydro... CAS#:6362-52-3 |
| Literature: Riegel; Post; Reid Journal of the American Chemical Society, 1929 , vol. 51, p. 508 |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 6-Nitro-4-amino-phenol-sulfonsaeure-(2) |
| 5-Amino-2-hydroxy-3-nitro-benzolsulfonsaeure |
| Benzenesulfonic acid,5-amino-2-hydroxy-3-nitro |
| Metanilicacid,6-hydroxy-5-nitro-(8CI) |
| 5-amino-2-hydroxy-3-nitro-benzenesulfonic acid |
| 5-Amino-2-hydroxy-3-nitrobenzenesulphonic acid |
| EINECS 228-843-1 |