Sodium 3,5-dicarboxybenzenesulfonate structure
|
Common Name | Sodium 3,5-dicarboxybenzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 6362-79-4 | Molecular Weight | 268.176 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H5NaO7S | Melting Point | 373 °C | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5-Sulfoisophthalic Acid Monosodium Salt |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 373 °C |
|---|---|
| Molecular Formula | C8H5NaO7S |
| Molecular Weight | 268.176 |
| Exact Mass | 267.965363 |
| PSA | 140.18000 |
| LogP | 1.06790 |
| InChIKey | YXTFRJVQOWZDPP-UHFFFAOYSA-M |
| SMILES | O=C(O)c1cc(C(=O)O)cc(S(=O)(=O)[O-])c1.[Na+] |
| Water Solubility | 380 g/L |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | C:Corrosive; |
| Risk Phrases | R34 |
| Safety Phrases | S26-S37/39-S45-S36/37/39-S25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 2 |
| RTECS | DB6030000 |
| HS Code | 2917399090 |
|
~92%
Sodium 3,5-dica... CAS#:6362-79-4 |
| Literature: OSTER, Timothy Patent: WO2013/25784 A2, 2013 ; Location in patent: Paragraph 0058; 0059 ; |
|
~%
Sodium 3,5-dica... CAS#:6362-79-4 |
| Literature: WO2013/25784 A2, ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| EINECS 228-845-2 |
| Sodium 3,5-dicarboxybenzenesulfonate |
| 1,3-Benzenedicarboxylic acid |
| 5-Sulfoisophthalic acid monosodium salt |
| MFCD00007495 |
| 1,3-Benzenedicarboxylic acid, 5-sulfo-, sodium salt (1:1) |